C18H25N3O2 — CID 167061368
methyl (2Z,4Z)-2,4-dicyano-3-propyl-5-pyrrolidin-1-ylocta-2,4-dienoate (PubChem CID 167061368) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is methyl (2Z,4Z)-2,4-dicyano-3-propyl-5-pyrrolidin-1-ylocta-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-2,4-dicyano-3-propyl-5-pyrrolidin-1-ylocta-2,4-dienoate |
|---|---|
| PubChem CID | 167061368 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | methyl (2Z,4Z)-2,4-dicyano-3-propyl-5-pyrrolidin-1-ylocta-2,4-dienoate |
| SMILES | CCCC(=C(\C#N)C(=O)OC)/C(C#N)=C(\CCC)N1CCCC1 |
| InChI | InChI=1S/C18H25N3O2/c1-4-8-14(16(13-20)18(22)23-3)15(12-19)17(9-5-2)21-10-6-7-11-21/h4-11H2,1-3H3/b16-14-,17-15+ |
| InChIKey | IJDOYJHEPCJRFJ-QUDUTFMFSA-N |
| XLogP | 3.45 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|