C30H34F9N5 — CID 167061587
(6E)-2-[6-[[2-cyano-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]hexylamino]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile (PubChem CID 167061587) has the molecular formula C30H34F9N5 and a molecular weight of 635.62 g/mol. Its IUPAC name is (6E)-2-[6-[[2-cyano-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]hexylamino]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile.
| Compound Name | (6E)-2-[6-[[2-cyano-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]hexylamino]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 167061587 |
| Molecular Formula | C30H34F9N5 |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | (6E)-2-[6-[[2-cyano-3-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-5,5-dimethylcyclohexen-1-yl]amino]hexylamino]-6-(1-cyano-2,2,2-trifluoroethylidene)-4,4-dimethylcyclohexene-1-carbonitrile |
| SMILES | CC1(C)CC(NCCCCCCNC2=C(C#N)/C(=C(\C#N)C(F)(F)F)CC(C)(C)C2)=C(C#N)C(=C(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C30H34F9N5/c1-26(2)11-18(22(17-42)28(31,32)33)20(15-40)23(13-26)43-9-7-5-6-8-10-44-24-14-27(3,4)12-19(21(24)16-41)25(29(34,35)36)30(37,38)39/h43-44H,5-14H2,1-4H3/b22-18+ |
| InChIKey | OQNFPQFICVLUKI-RELWKKBWSA-N |
| XLogP | 8.73 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|