About 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol
1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol (PubChem CID 167061964) has the molecular formula C12H17ClN4O
and a molecular weight of 268.75 g/mol. Its IUPAC name is 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol.
Molecular Properties
| Compound Name | 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol |
| PubChem CID | 167061964 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol |
| SMILES | CCCCC(O)c1ccc(Cl)cc1C1=NNNN1 |
| InChI | InChI=1S/C12H17ClN4O/c1-2-3-4-11(18)9-6-5-8(13)7-10(9)12-14-16-17-15-12/h5-7,11,16-18H,2-4H2,1H3,(H,14,15) |
| InChIKey | YLJGJLXNGYIWOE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol?
The IUPAC name of 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol (CID 167061964) is 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol.
What is the SMILES notation for 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol?
The canonical SMILES for 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol is CCCCC(O)c1ccc(Cl)cc1C1=NNNN1.
What is the InChIKey of 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol?
The InChIKey is YLJGJLXNGYIWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClN4O/c1-2-3-4-11(18)9-6-5-8(13)7-10(9)12-14-16-17-15-12/h5-7,11,16-18H,2-4H2,1H3,(H,14,15).
What are the key properties of 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol?
1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol has a molecular weight of 268.75 g/mol, XLogP of 1.84, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-chloro-2-(2,3-dihydro-1H-tetrazol-5-yl)phenyl]pentan-1-ol is sourced from PubChem (CID 167061964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).