About 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran
5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran (PubChem CID 167062080) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran.
Molecular Properties
| Compound Name | 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran |
| PubChem CID | 167062080 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran |
| SMILES | CC(C)(C)CC1=CC2C=COC2C=C1 |
| InChI | InChI=1S/C13H18O/c1-13(2,3)9-10-4-5-12-11(8-10)6-7-14-12/h4-8,11-12H,9H2,1-3H3 |
| InChIKey | RZZJZBMAZQESRX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran?
The IUPAC name of 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran (CID 167062080) is 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran.
What is the SMILES notation for 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran?
The canonical SMILES for 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran is CC(C)(C)CC1=CC2C=COC2C=C1.
What is the InChIKey of 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran?
The InChIKey is RZZJZBMAZQESRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-13(2,3)9-10-4-5-12-11(8-10)6-7-14-12/h4-8,11-12H,9H2,1-3H3.
What are the key properties of 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran?
5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran has a molecular weight of 190.29 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-dimethylpropyl)-3a,7a-dihydro-1-benzofuran is sourced from PubChem (CID 167062080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).