About methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate
methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate (PubChem CID 167062202) has the molecular formula C7H12F2N2O
and a molecular weight of 178.18 g/mol. Its IUPAC name is methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate.
Molecular Properties
| Compound Name | methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate |
| PubChem CID | 167062202 |
| Molecular Formula | C7H12F2N2O |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate |
| SMILES | C=C/N=C(\OC)N(C)CC(F)F |
| InChI | InChI=1S/C7H12F2N2O/c1-4-10-7(12-3)11(2)5-6(8)9/h4,6H,1,5H2,2-3H3/b10-7- |
| InChIKey | RQUWWFWVVNPKAW-YFHOEESVSA-N |
| XLogP | 1.33 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate?
The IUPAC name of methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate (CID 167062202) is methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate.
What is the SMILES notation for methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate?
The canonical SMILES for methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate is C=C/N=C(\OC)N(C)CC(F)F.
What is the InChIKey of methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate?
The InChIKey is RQUWWFWVVNPKAW-YFHOEESVSA-N. The full InChI is InChI=1S/C7H12F2N2O/c1-4-10-7(12-3)11(2)5-6(8)9/h4,6H,1,5H2,2-3H3/b10-7-.
What are the key properties of methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate?
methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate has a molecular weight of 178.18 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,2-difluoroethyl)-N'-ethenyl-N-methylcarbamimidate is sourced from PubChem (CID 167062202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).