C27H34O10 — CID 167062409
(4Z,6Z)-3',13-dihydroxy-1'-(hydroxymethyl)-12,18-dimethylspiro[2,9,15,20-tetraoxatetracyclo[16.5.0.019,21.019,22]tricosa-4,6-diene-17,4'-cyclohexene]-3,8,14-trione (PubChem CID 167062409) has the molecular formula C27H34O10 and a molecular weight of 518.56 g/mol. Its IUPAC name is (4Z,6Z)-3',13-dihydroxy-1'-(hydroxymethyl)-12,18-dimethylspiro[2,9,15,20-tetraoxatetracyclo[16.5.0.019,21.019,22]tricosa-4,6-diene-17,4'-cyclohexene]-3,8,14-trione.
| Compound Name | (4Z,6Z)-3',13-dihydroxy-1'-(hydroxymethyl)-12,18-dimethylspiro[2,9,15,20-tetraoxatetracyclo[16.5.0.019,21.019,22]tricosa-4,6-diene-17,4'-cyclohexene]-3,8,14-trione |
|---|---|
| PubChem CID | 167062409 |
| Molecular Formula | C27H34O10 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (4Z,6Z)-3',13-dihydroxy-1'-(hydroxymethyl)-12,18-dimethylspiro[2,9,15,20-tetraoxatetracyclo[16.5.0.019,21.019,22]tricosa-4,6-diene-17,4'-cyclohexene]-3,8,14-trione |
| SMILES | CC1CCOC(=O)/C=C\C=C/C(=O)OC2CC3C4OC34C2(C)C2(CCC(CO)=CC2O)COC(=O)C1O |
| InChI | InChI=1S/C27H34O10/c1-15-8-10-34-20(30)5-3-4-6-21(31)36-19-12-17-23-27(17,37-23)25(19,2)26(14-35-24(33)22(15)32)9-7-16(13-28)11-18(26)29/h3-6,11,15,17-19,22-23,28-29,32H,7-10,12-14H2,1-2H3/b5-3-,6-4- |
| InChIKey | OWYRMDXABYSTAT-GLIMQPGKSA-N |
| XLogP | 0.73 |
| TPSA | 152.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|