C20H27N5O5 — CID 167062608
[(3aR,4R,6R,6aR)-4-cyano-4-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropanoate (PubChem CID 167062608) has the molecular formula C20H27N5O5 and a molecular weight of 417.47 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-cyano-4-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(3aR,4R,6R,6aR)-4-cyano-4-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167062608 |
| Molecular Formula | C20H27N5O5 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-cyano-4-[5-(N'-methanimidoylcarbamimidoyl)-1H-pyrrol-2-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl 2,2-dimethylpropanoate |
| SMILES | [H]/N=C/N=C(\N)c1ccc([C@]2(C#N)O[C@H](COC(=O)C(C)(C)C)[C@H]3OC(C)(C)O[C@H]32)[nH]1 |
| InChI | InChI=1S/C20H27N5O5/c1-18(2,3)17(26)27-8-12-14-15(30-19(4,5)29-14)20(9-21,28-12)13-7-6-11(25-13)16(23)24-10-22/h6-7,10,12,14-15,25H,8H2,1-5H3,(H3,22,23,24)/t12-,14-,15-,20+/m1/s1 |
| InChIKey | LRGJKBKQGQUDDZ-IEUIXRIBSA-N |
| XLogP | 1.55 |
| TPSA | 155.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|