C16H17FN2O2S — CID 167062663
N-[1-(4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]-5-methylthiophene-2-carboxamide (PubChem CID 167062663) has the molecular formula C16H17FN2O2S and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[1-(4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[1-(4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 167062663 |
| Molecular Formula | C16H17FN2O2S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[1-(4-fluoroanilino)-2-methyl-1-oxopropan-2-yl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(C)(C)C(=O)Nc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C16H17FN2O2S/c1-10-4-9-13(22-10)14(20)19-16(2,3)15(21)18-12-7-5-11(17)6-8-12/h4-9H,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | FGIQRTCTLATJDQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |