About 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one
2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one (PubChem CID 167063085) has the molecular formula C7H11N3O3
and a molecular weight of 185.18 g/mol. Its IUPAC name is 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one |
| PubChem CID | 167063085 |
| Molecular Formula | C7H11N3O3 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one |
| SMILES | Nc1nc(=O)ccn1C[C@H](O)CO |
| InChI | InChI=1S/C7H11N3O3/c8-7-9-6(13)1-2-10(7)3-5(12)4-11/h1-2,5,11-12H,3-4H2,(H2,8,9,13)/t5-/m0/s1 |
| InChIKey | KAJYILDLOCPTGK-YFKPBYRVSA-N |
| XLogP | -1.82 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one?
The IUPAC name of 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one (CID 167063085) is 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one.
What is the SMILES notation for 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one?
The canonical SMILES for 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one is Nc1nc(=O)ccn1C[C@H](O)CO.
What is the InChIKey of 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one?
The InChIKey is KAJYILDLOCPTGK-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11N3O3/c8-7-9-6(13)1-2-10(7)3-5(12)4-11/h1-2,5,11-12H,3-4H2,(H2,8,9,13)/t5-/m0/s1.
What are the key properties of 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one?
2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one has a molecular weight of 185.18 g/mol, XLogP of -1.82, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-4-one is sourced from PubChem (CID 167063085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).