C17H22N4O2 — CID 167063109
3-methyl-N-[2-[[(6-oxo-1H-pyrimidin-4-yl)amino]methyl]phenyl]pentanamide (PubChem CID 167063109) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-methyl-N-[2-[[(6-oxo-1H-pyrimidin-4-yl)amino]methyl]phenyl]pentanamide.
| Compound Name | 3-methyl-N-[2-[[(6-oxo-1H-pyrimidin-4-yl)amino]methyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 167063109 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-methyl-N-[2-[[(6-oxo-1H-pyrimidin-4-yl)amino]methyl]phenyl]pentanamide |
| SMILES | CCC(C)CC(=O)Nc1ccccc1CNc1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C17H22N4O2/c1-3-12(2)8-17(23)21-14-7-5-4-6-13(14)10-18-15-9-16(22)20-11-19-15/h4-7,9,11-12H,3,8,10H2,1-2H3,(H,21,23)(H2,18,19,20,22) |
| InChIKey | XVGLJVLNAQLVRH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |