About 2-ethyl-N,3-dimethylbut-2-en-1-imine
2-ethyl-N,3-dimethylbut-2-en-1-imine (PubChem CID 167063120) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 2-ethyl-N,3-dimethylbut-2-en-1-imine.
Molecular Properties
| Compound Name | 2-ethyl-N,3-dimethylbut-2-en-1-imine |
| PubChem CID | 167063120 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 2-ethyl-N,3-dimethylbut-2-en-1-imine |
| SMILES | CCC(/C=N/C)=C(C)C |
| InChI | InChI=1S/C8H15N/c1-5-8(6-9-4)7(2)3/h6H,5H2,1-4H3/b9-6+ |
| InChIKey | GRGIFJXOBSFQSG-RMKNXTFCSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N,3-dimethylbut-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N,3-dimethylbut-2-en-1-imine?
The IUPAC name of 2-ethyl-N,3-dimethylbut-2-en-1-imine (CID 167063120) is 2-ethyl-N,3-dimethylbut-2-en-1-imine.
What is the SMILES notation for 2-ethyl-N,3-dimethylbut-2-en-1-imine?
The canonical SMILES for 2-ethyl-N,3-dimethylbut-2-en-1-imine is CCC(/C=N/C)=C(C)C.
What is the InChIKey of 2-ethyl-N,3-dimethylbut-2-en-1-imine?
The InChIKey is GRGIFJXOBSFQSG-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H15N/c1-5-8(6-9-4)7(2)3/h6H,5H2,1-4H3/b9-6+.
What are the key properties of 2-ethyl-N,3-dimethylbut-2-en-1-imine?
2-ethyl-N,3-dimethylbut-2-en-1-imine has a molecular weight of 125.21 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N,3-dimethylbut-2-en-1-imine is sourced from PubChem (CID 167063120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).