C23H20Cl2FN5O4S — CID 167063195
(2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(2,4-dichloro-3-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-methyloxane-2-carboxamide (PubChem CID 167063195) has the molecular formula C23H20Cl2FN5O4S and a molecular weight of 552.42 g/mol. Its IUPAC name is (2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(2,4-dichloro-3-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-methyloxane-2-carboxamide.
| Compound Name | (2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(2,4-dichloro-3-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 167063195 |
| Molecular Formula | C23H20Cl2FN5O4S |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | (2R,4R,5R,6R)-N-(1,3-benzothiazol-6-yl)-4-[4-(2,4-dichloro-3-fluorophenyl)triazol-1-yl]-5-hydroxy-6-(hydroxymethyl)-N-methyloxane-2-carboxamide |
| SMILES | CN(C(=O)[C@H]1CC(n2cc(-c3ccc(Cl)c(F)c3Cl)nn2)[C@@H](O)[C@@H](CO)O1)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C23H20Cl2FN5O4S/c1-30(11-2-5-14-19(6-11)36-10-27-14)23(34)17-7-16(22(33)18(9-32)35-17)31-8-15(28-29-31)12-3-4-13(24)21(26)20(12)25/h2-6,8,10,16-18,22,32-33H,7,9H2,1H3/t16?,17-,18-,22-/m1/s1 |
| InChIKey | WSKVQXJBHPINLM-PKFPGOFKSA-N |
| XLogP | 3.72 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|