About 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one
2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one (PubChem CID 167063297) has the molecular formula C12H20N6O2
and a molecular weight of 280.33 g/mol. Its IUPAC name is 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one |
| PubChem CID | 167063297 |
| Molecular Formula | C12H20N6O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one |
| SMILES | CCC1CN(C)CC(N2CNc3c2nc(N)[nH]c3=O)O1 |
| InChI | InChI=1S/C12H20N6O2/c1-3-7-4-17(2)5-8(20-7)18-6-14-9-10(18)15-12(13)16-11(9)19/h7-8,14H,3-6H2,1-2H3,(H3,13,15,16,19) |
| InChIKey | ODUQRRYDPAFMRB-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one?
The IUPAC name of 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one (CID 167063297) is 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one.
What is the SMILES notation for 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one?
The canonical SMILES for 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one is CCC1CN(C)CC(N2CNc3c2nc(N)[nH]c3=O)O1.
What is the InChIKey of 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one?
The InChIKey is ODUQRRYDPAFMRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N6O2/c1-3-7-4-17(2)5-8(20-7)18-6-14-9-10(18)15-12(13)16-11(9)19/h7-8,14H,3-6H2,1-2H3,(H3,13,15,16,19).
What are the key properties of 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one?
2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one has a molecular weight of 280.33 g/mol, XLogP of -0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(6-ethyl-4-methylmorpholin-2-yl)-7,8-dihydro-1H-purin-6-one is sourced from PubChem (CID 167063297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).