C6H12NOP — CID 167063305
(3R,3aS)-3-methyl-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphole (PubChem CID 167063305) has the molecular formula C6H12NOP and a molecular weight of 145.14 g/mol. Its IUPAC name is (3R,3aS)-3-methyl-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphole.
| Compound Name | (3R,3aS)-3-methyl-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphole |
|---|---|
| PubChem CID | 167063305 |
| Molecular Formula | C6H12NOP |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (3R,3aS)-3-methyl-1,3,3a,4,5,6-hexahydropyrrolo[1,2-c][1,3,2]oxazaphosphole |
| SMILES | C[C@H]1OPN2CCC[C@@H]12 |
| InChI | InChI=1S/C6H12NOP/c1-5-6-3-2-4-7(6)9-8-5/h5-6,9H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | DPBMUNVRDUIFOL-RITPCOANSA-N |
| XLogP | 1.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|