C17H22FN3O6 — CID 167063367
(2S,5aR,7R,8R,9R,9aR)-9-[(ethyldiazenyl)-fluoroamino]-8-hydroxy-2-phenyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepine-7-carboxylic acid (PubChem CID 167063367) has the molecular formula C17H22FN3O6 and a molecular weight of 383.38 g/mol. Its IUPAC name is (2S,5aR,7R,8R,9R,9aR)-9-[(ethyldiazenyl)-fluoroamino]-8-hydroxy-2-phenyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepine-7-carboxylic acid.
| Compound Name | (2S,5aR,7R,8R,9R,9aR)-9-[(ethyldiazenyl)-fluoroamino]-8-hydroxy-2-phenyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepine-7-carboxylic acid |
|---|---|
| PubChem CID | 167063367 |
| Molecular Formula | C17H22FN3O6 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (2S,5aR,7R,8R,9R,9aR)-9-[(ethyldiazenyl)-fluoroamino]-8-hydroxy-2-phenyl-5,5a,7,8,9,9a-hexahydro-4H-pyrano[3,2-d][1,3]dioxepine-7-carboxylic acid |
| SMILES | CC/N=N/N(F)[C@@H]1[C@@H](O)[C@H](C(=O)O)O[C@@H]2CCO[C@H](c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C17H22FN3O6/c1-2-19-20-21(18)12-13(22)15(16(23)24)26-11-8-9-25-17(27-14(11)12)10-6-4-3-5-7-10/h3-7,11-15,17,22H,2,8-9H2,1H3,(H,23,24)/b20-19+/t11-,12-,13-,14+,15-,17+/m1/s1 |
| InChIKey | KSFLIWWWVQONEI-ZBFMJTOLSA-N |
| XLogP | 1.65 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|