C17H22FN3O6 — CID 167063372
(4aR,7R,8R,8aR)-8-[(ethyldiazenyl)-fluoroamino]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid (PubChem CID 167063372) has the molecular formula C17H22FN3O6 and a molecular weight of 383.38 g/mol. Its IUPAC name is (4aR,7R,8R,8aR)-8-[(ethyldiazenyl)-fluoroamino]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid.
| Compound Name | (4aR,7R,8R,8aR)-8-[(ethyldiazenyl)-fluoroamino]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 167063372 |
| Molecular Formula | C17H22FN3O6 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | (4aR,7R,8R,8aR)-8-[(ethyldiazenyl)-fluoroamino]-7-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
| SMILES | CC/N=N/N(F)[C@H]1[C@H]2OC(c3ccccc3)OC[C@H]2OC(C(=O)O)[C@@H]1OC |
| InChI | InChI=1S/C17H22FN3O6/c1-3-19-20-21(18)12-13-11(26-15(16(22)23)14(12)24-2)9-25-17(27-13)10-7-5-4-6-8-10/h4-8,11-15,17H,3,9H2,1-2H3,(H,22,23)/b20-19+/t11-,12+,13+,14-,15?,17?/m1/s1 |
| InChIKey | NIXNJXWACXQXEB-RWIFZCJMSA-N |
| XLogP | 1.91 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|