C21H30F2N6O — CID 167063381
2-[(Z)-1-amino-2-[7-amino-2-[(3,3-difluoropiperidin-4-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl]ethenyl]phenol (PubChem CID 167063381) has the molecular formula C21H30F2N6O and a molecular weight of 420.51 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-[7-amino-2-[(3,3-difluoropiperidin-4-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl]ethenyl]phenol.
| Compound Name | 2-[(Z)-1-amino-2-[7-amino-2-[(3,3-difluoropiperidin-4-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl]ethenyl]phenol |
|---|---|
| PubChem CID | 167063381 |
| Molecular Formula | C21H30F2N6O |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2-[(Z)-1-amino-2-[7-amino-2-[(3,3-difluoropiperidin-4-yl)methyl]-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-6-yl]ethenyl]phenol |
| SMILES | NC1=C(/C=C(\N)c2ccccc2O)N2CCN(CC3CCNCC3(F)F)CC2CN1 |
| InChI | InChI=1S/C21H30F2N6O/c22-21(23)13-26-6-5-14(21)11-28-7-8-29-15(12-28)10-27-20(25)18(29)9-17(24)16-3-1-2-4-19(16)30/h1-4,9,14-15,26-27,30H,5-8,10-13,24-25H2/b17-9- |
| InChIKey | IXODTMIHAHKLOC-MFOYZWKCSA-N |
| XLogP | 0.65 |
| TPSA | 102.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |