C15H18FN3O6 — CID 167063427
(2S,4aR,6R,7R,8R,8aR)-8-[fluoro-(methyldiazenyl)amino]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid (PubChem CID 167063427) has the molecular formula C15H18FN3O6 and a molecular weight of 355.32 g/mol. Its IUPAC name is (2S,4aR,6R,7R,8R,8aR)-8-[fluoro-(methyldiazenyl)amino]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid.
| Compound Name | (2S,4aR,6R,7R,8R,8aR)-8-[fluoro-(methyldiazenyl)amino]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
|---|---|
| PubChem CID | 167063427 |
| Molecular Formula | C15H18FN3O6 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | (2S,4aR,6R,7R,8R,8aR)-8-[fluoro-(methyldiazenyl)amino]-7-hydroxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-6-carboxylic acid |
| SMILES | C/N=N/N(F)[C@@H]1[C@@H](O)[C@H](C(=O)O)O[C@@H]2CO[C@H](c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C15H18FN3O6/c1-17-18-19(16)10-11(20)13(14(21)22)24-9-7-23-15(25-12(9)10)8-5-3-2-4-6-8/h2-6,9-13,15,20H,7H2,1H3,(H,21,22)/b18-17+/t9-,10-,11-,12+,13-,15+/m1/s1 |
| InChIKey | CDEJYGZKGBYFEV-LPKGSQHHSA-N |
| XLogP | 0.87 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|