C33H36N6O3 — CID 167063690
N-[[4-[8-amino-3-[1-[3-(but-2-ynoylamino)propyl]cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]methyl]-2-methoxybenzamide (PubChem CID 167063690) has the molecular formula C33H36N6O3 and a molecular weight of 564.69 g/mol. Its IUPAC name is N-[[4-[8-amino-3-[1-[3-(but-2-ynoylamino)propyl]cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[4-[8-amino-3-[1-[3-(but-2-ynoylamino)propyl]cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 167063690 |
| Molecular Formula | C33H36N6O3 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.28 |
| IUPAC Name | N-[[4-[8-amino-3-[1-[3-(but-2-ynoylamino)propyl]cyclopentyl]imidazo[1,5-a]pyrazin-1-yl]phenyl]methyl]-2-methoxybenzamide |
| SMILES | CC#CC(=O)NCCCC1(c2nc(-c3ccc(CNC(=O)c4ccccc4OC)cc3)c3c(N)nccn23)CCCC1 |
| InChI | InChI=1S/C33H36N6O3/c1-3-9-27(40)35-19-8-18-33(16-6-7-17-33)32-38-28(29-30(34)36-20-21-39(29)32)24-14-12-23(13-15-24)22-37-31(41)25-10-4-5-11-26(25)42-2/h4-5,10-15,20-21H,6-8,16-19,22H2,1-2H3,(H2,34,36)(H,35,40)(H,37,41) |
| InChIKey | YNKDWCOUDINFOK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|