About 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide
2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide (PubChem CID 167063749) has the molecular formula C15H22O5S3
and a molecular weight of 378.54 g/mol. Its IUPAC name is 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide |
| PubChem CID | 167063749 |
| Molecular Formula | C15H22O5S3 |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide |
| SMILES | CC1CC(CC2=CC=C(CC3CCS(=O)C3)S2(=O)=O)CS1(=O)=O |
| InChI | InChI=1S/C15H22O5S3/c1-11-6-13(10-22(11,17)18)8-15-3-2-14(23(15,19)20)7-12-4-5-21(16)9-12/h2-3,11-13H,4-10H2,1H3 |
| InChIKey | XOLIBFHHBMIRQI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide?
The IUPAC name of 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide (CID 167063749) is 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide.
What is the SMILES notation for 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide?
The canonical SMILES for 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide is CC1CC(CC2=CC=C(CC3CCS(=O)C3)S2(=O)=O)CS1(=O)=O.
What is the InChIKey of 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide?
The InChIKey is XOLIBFHHBMIRQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O5S3/c1-11-6-13(10-22(11,17)18)8-15-3-2-14(23(15,19)20)7-12-4-5-21(16)9-12/h2-3,11-13H,4-10H2,1H3.
What are the key properties of 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide?
2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide has a molecular weight of 378.54 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,1-dioxothiolan-3-yl)methyl]-5-[(1-oxothiolan-3-yl)methyl]thiophene 1,1-dioxide is sourced from PubChem (CID 167063749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).