C24H21FN6O2S — CID 167064351
(12E,15S)-22-(3-fluoro-2-methoxyanilino)-23-thia-5,8,10,17,21-pentazapentacyclo[17.2.1.16,9.02,7.015,20]tricosa-1(22),2(7),3,5,8,12,19-heptaen-18-one (PubChem CID 167064351) has the molecular formula C24H21FN6O2S and a molecular weight of 476.54 g/mol. Its IUPAC name is (12E,15S)-22-(3-fluoro-2-methoxyanilino)-23-thia-5,8,10,17,21-pentazapentacyclo[17.2.1.16,9.02,7.015,20]tricosa-1(22),2(7),3,5,8,12,19-heptaen-18-one.
| Compound Name | (12E,15S)-22-(3-fluoro-2-methoxyanilino)-23-thia-5,8,10,17,21-pentazapentacyclo[17.2.1.16,9.02,7.015,20]tricosa-1(22),2(7),3,5,8,12,19-heptaen-18-one |
|---|---|
| PubChem CID | 167064351 |
| Molecular Formula | C24H21FN6O2S |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (12E,15S)-22-(3-fluoro-2-methoxyanilino)-23-thia-5,8,10,17,21-pentazapentacyclo[17.2.1.16,9.02,7.015,20]tricosa-1(22),2(7),3,5,8,12,19-heptaen-18-one |
| SMILES | COc1c(F)cccc1Nc1c2[nH]c3c1C(=O)NC[C@@H]3C/C=C/CNc1nc3c-2ccnc3s1 |
| InChI | InChI=1S/C24H21FN6O2S/c1-33-21-14(25)6-4-7-15(21)29-20-16-17-12(11-28-22(16)32)5-2-3-9-27-24-31-19-13(18(20)30-17)8-10-26-23(19)34-24/h2-4,6-8,10,12,29-30H,5,9,11H2,1H3,(H,27,31)(H,28,32)/b3-2+/t12-/m0/s1 |
| InChIKey | ZAGGNIUYIMJSPL-JDGPPOGSSA-N |
| XLogP | 4.78 |
| TPSA | 103.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|