C22H32N2 — CID 167065049
(4S,6Z,8Z)-4,8-dimethyl-4-[(3E,5Z)-8-methyl-4-prop-1-en-2-ylnona-1,3,5,8-tetraen-3-yl]-1,2,3,5-tetrahydro-1,3-diazonine (PubChem CID 167065049) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is (4S,6Z,8Z)-4,8-dimethyl-4-[(3E,5Z)-8-methyl-4-prop-1-en-2-ylnona-1,3,5,8-tetraen-3-yl]-1,2,3,5-tetrahydro-1,3-diazonine.
| Compound Name | (4S,6Z,8Z)-4,8-dimethyl-4-[(3E,5Z)-8-methyl-4-prop-1-en-2-ylnona-1,3,5,8-tetraen-3-yl]-1,2,3,5-tetrahydro-1,3-diazonine |
|---|---|
| PubChem CID | 167065049 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | (4S,6Z,8Z)-4,8-dimethyl-4-[(3E,5Z)-8-methyl-4-prop-1-en-2-ylnona-1,3,5,8-tetraen-3-yl]-1,2,3,5-tetrahydro-1,3-diazonine |
| SMILES | C=C/C(=C(/C=C\CC(=C)C)C(=C)C)[C@]1(C)C/C=C\C(C)=C/NCN1 |
| InChI | InChI=1S/C22H32N2/c1-8-21(20(18(4)5)13-9-11-17(2)3)22(7)14-10-12-19(6)15-23-16-24-22/h8-10,12-13,15,23-24H,1-2,4,11,14,16H2,3,5-7H3/b12-10-,13-9-,19-15-,21-20+/t22-/m0/s1 |
| InChIKey | ZRSKSFVZHBGJLK-KBOMIFOXSA-N |
| XLogP | 5.33 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|