C12H15N3 — CID 167065102
3-but-3-en-2-yl-3,7-dihydropyridazino[1,6-a][1,3]diazepine (PubChem CID 167065102) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-but-3-en-2-yl-3,7-dihydropyridazino[1,6-a][1,3]diazepine.
| Compound Name | 3-but-3-en-2-yl-3,7-dihydropyridazino[1,6-a][1,3]diazepine |
|---|---|
| PubChem CID | 167065102 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-but-3-en-2-yl-3,7-dihydropyridazino[1,6-a][1,3]diazepine |
| SMILES | C=CC(C)C1C=NN2C=CCC=NC2=C1 |
| InChI | InChI=1S/C12H15N3/c1-3-10(2)11-8-12-13-6-4-5-7-15(12)14-9-11/h3,5-11H,1,4H2,2H3 |
| InChIKey | JYHMALUEESKVGS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|