C29H27F2N5OS — CID 167065155
S-[4-[6-[4-(1,1-difluoro-2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine (PubChem CID 167065155) has the molecular formula C29H27F2N5OS and a molecular weight of 531.63 g/mol. Its IUPAC name is S-[4-[6-[4-(1,1-difluoro-2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine.
| Compound Name | S-[4-[6-[4-(1,1-difluoro-2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 167065155 |
| Molecular Formula | C29H27F2N5OS |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | S-[4-[6-[4-(1,1-difluoro-2-piperidin-1-ylethoxy)phenyl]pyrazolo[1,5-a]pyrimidin-3-yl]naphthalen-1-yl]thiohydroxylamine |
| SMILES | NSc1ccc(-c2cnn3cc(-c4ccc(OC(F)(F)CN5CCCCC5)cc4)cnc23)c2ccccc12 |
| InChI | InChI=1S/C29H27F2N5OS/c30-29(31,19-35-14-4-1-5-15-35)37-22-10-8-20(9-11-22)21-16-33-28-26(17-34-36(28)18-21)24-12-13-27(38-32)25-7-3-2-6-23(24)25/h2-3,6-13,16-18H,1,4-5,14-15,19,32H2 |
| InChIKey | RTELXBFCKDIOKS-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|