C16H25F3N2O3 — CID 167065179
(1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 167065179) has the molecular formula C16H25F3N2O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 167065179 |
| Molecular Formula | C16H25F3N2O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (1R,2S,5S)-3-[(2S)-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | CC(C)(C)[C@@H](CN1C[C@H]2[C@@H]([C@H]1C(=O)O)C2(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C16H25F3N2O3/c1-14(2,3)9(20-13(24)16(17,18)19)7-21-6-8-10(15(8,4)5)11(21)12(22)23/h8-11H,6-7H2,1-5H3,(H,20,24)(H,22,23)/t8-,9+,10-,11-/m0/s1 |
| InChIKey | HMHVGYURXACGMA-VLEAKVRGSA-N |
| XLogP | 2.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |