C27H34N4O4 — CID 167065875
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(5-methoxy-1,2-dimethyl-3H-1,2,4-triazole-3-carbonyl)-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 167065875) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(5-methoxy-1,2-dimethyl-3H-1,2,4-triazole-3-carbonyl)-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(5-methoxy-1,2-dimethyl-3H-1,2,4-triazole-3-carbonyl)-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 167065875 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-(5-methoxy-1,2-dimethyl-3H-1,2,4-triazole-3-carbonyl)-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(C(=O)C4N=C(OC)N(C)N4C)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C27H34N4O4/c1-7-8-19-13-17(2)22(18(3)14-19)23-20(32)15-27(16-21(23)33)9-11-31(12-10-27)25(34)24-28-26(35-6)30(5)29(24)4/h13-14,23-24H,9-12,15-16H2,1-6H3 |
| InChIKey | GBLURCMRJUEKPU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|