C26H28N2O2S — CID 167065880
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-pyridin-2-ylsulfanyl-3-azaspiro[5.5]undecane-8,10-dione (PubChem CID 167065880) has the molecular formula C26H28N2O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-pyridin-2-ylsulfanyl-3-azaspiro[5.5]undecane-8,10-dione.
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-pyridin-2-ylsulfanyl-3-azaspiro[5.5]undecane-8,10-dione |
|---|---|
| PubChem CID | 167065880 |
| Molecular Formula | C26H28N2O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-pyridin-2-ylsulfanyl-3-azaspiro[5.5]undecane-8,10-dione |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCN(Sc4ccccn4)CC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C26H28N2O2S/c1-4-7-20-14-18(2)24(19(3)15-20)25-21(29)16-26(17-22(25)30)9-12-28(13-10-26)31-23-8-5-6-11-27-23/h5-6,8,11,14-15,25H,9-10,12-13,16-17H2,1-3H3 |
| InChIKey | RNOFHTPBYSLDGV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|