C29H36FIN6O2 — CID 167066097
(Z)-N-[7-(4-fluoro-4-iodopiperidin-1-yl)-2-(3-hydroxy-3-methylbutyl)imidazo[1,2-a]pyridin-6-yl]-2-[1-(2-methyl-4-pyridinyl)ethylideneamino]but-2-enamide (PubChem CID 167066097) has the molecular formula C29H36FIN6O2 and a molecular weight of 646.55 g/mol. Its IUPAC name is (Z)-N-[7-(4-fluoro-4-iodopiperidin-1-yl)-2-(3-hydroxy-3-methylbutyl)imidazo[1,2-a]pyridin-6-yl]-2-[1-(2-methyl-4-pyridinyl)ethylideneamino]but-2-enamide.
| Compound Name | (Z)-N-[7-(4-fluoro-4-iodopiperidin-1-yl)-2-(3-hydroxy-3-methylbutyl)imidazo[1,2-a]pyridin-6-yl]-2-[1-(2-methyl-4-pyridinyl)ethylideneamino]but-2-enamide |
|---|---|
| PubChem CID | 167066097 |
| Molecular Formula | C29H36FIN6O2 |
| Molecular Weight | 646.55 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | (Z)-N-[7-(4-fluoro-4-iodopiperidin-1-yl)-2-(3-hydroxy-3-methylbutyl)imidazo[1,2-a]pyridin-6-yl]-2-[1-(2-methyl-4-pyridinyl)ethylideneamino]but-2-enamide |
| SMILES | C/C=C(\N=C(/C)c1ccnc(C)c1)C(=O)Nc1cn2cc(CCC(C)(C)O)nc2cc1N1CCC(F)(I)CC1 |
| InChI | InChI=1S/C29H36FIN6O2/c1-6-23(33-20(3)21-8-12-32-19(2)15-21)27(38)35-24-18-37-17-22(7-9-28(4,5)39)34-26(37)16-25(24)36-13-10-29(30,31)11-14-36/h6,8,12,15-18,39H,7,9-11,13-14H2,1-5H3,(H,35,38)/b23-6-,33-20+ |
| InChIKey | RIPXIEOKQZIFFH-GLIJXGBMSA-N |
| XLogP | 5.79 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|