C35H54N6 — CID 167066107
2-(3-methylbutyl)-N-[(3Z)-3-[[(Z,3E)-6-methyl-3-(2-methylpropylidene)oct-4-en-2-ylidene]amino]hexa-1,3,5-trien-2-yl]-7-piperazin-1-yl-2,3-dihydroimidazo[1,2-a]pyridin-6-amine (PubChem CID 167066107) has the molecular formula C35H54N6 and a molecular weight of 558.86 g/mol. Its IUPAC name is 2-(3-methylbutyl)-N-[(3Z)-3-[[(Z,3E)-6-methyl-3-(2-methylpropylidene)oct-4-en-2-ylidene]amino]hexa-1,3,5-trien-2-yl]-7-piperazin-1-yl-2,3-dihydroimidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-(3-methylbutyl)-N-[(3Z)-3-[[(Z,3E)-6-methyl-3-(2-methylpropylidene)oct-4-en-2-ylidene]amino]hexa-1,3,5-trien-2-yl]-7-piperazin-1-yl-2,3-dihydroimidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 167066107 |
| Molecular Formula | C35H54N6 |
| Molecular Weight | 558.86 g/mol |
| Exact Mass | 558.44 |
| IUPAC Name | 2-(3-methylbutyl)-N-[(3Z)-3-[[(Z,3E)-6-methyl-3-(2-methylpropylidene)oct-4-en-2-ylidene]amino]hexa-1,3,5-trien-2-yl]-7-piperazin-1-yl-2,3-dihydroimidazo[1,2-a]pyridin-6-amine |
| SMILES | C=C/C=C(\N=C(C)\C(/C=C\C(C)CC)=C\C(C)C)C(=C)NC1=CN2CC(CCC(C)C)N=C2C=C1N1CCNCC1 |
| InChI | InChI=1S/C35H54N6/c1-10-12-32(37-28(8)30(21-26(5)6)15-14-27(7)11-2)29(9)38-33-24-41-23-31(16-13-25(3)4)39-35(41)22-34(33)40-19-17-36-18-20-40/h10,12,14-15,21-22,24-27,31,36,38H,1,9,11,13,16-20,23H2,2-8H3/b15-14-,30-21+,32-12-,37-28+ |
| InChIKey | YKNHTFPMEAXDMW-RMUZBKONSA-N |
| XLogP | 6.97 |
| TPSA | 55.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.86 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|