About 2,5-difluoro-2,3-dihydropyridine
2,5-difluoro-2,3-dihydropyridine (PubChem CID 167066134) has the molecular formula C5H5F2N
and a molecular weight of 117.10 g/mol. Its IUPAC name is 2,5-difluoro-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2,5-difluoro-2,3-dihydropyridine |
| PubChem CID | 167066134 |
| Molecular Formula | C5H5F2N |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | 2,5-difluoro-2,3-dihydropyridine |
| SMILES | FC1=CCC(F)N=C1 |
| InChI | InChI=1S/C5H5F2N/c6-4-1-2-5(7)8-3-4/h1,3,5H,2H2 |
| InChIKey | WFYCKUJUYSEUIQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,5-difluoro-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-difluoro-2,3-dihydropyridine?
The IUPAC name of 2,5-difluoro-2,3-dihydropyridine (CID 167066134) is 2,5-difluoro-2,3-dihydropyridine.
What is the SMILES notation for 2,5-difluoro-2,3-dihydropyridine?
The canonical SMILES for 2,5-difluoro-2,3-dihydropyridine is FC1=CCC(F)N=C1.
What is the InChIKey of 2,5-difluoro-2,3-dihydropyridine?
The InChIKey is WFYCKUJUYSEUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F2N/c6-4-1-2-5(7)8-3-4/h1,3,5H,2H2.
What are the key properties of 2,5-difluoro-2,3-dihydropyridine?
2,5-difluoro-2,3-dihydropyridine has a molecular weight of 117.10 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-2,3-dihydropyridine is sourced from PubChem (CID 167066134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).