C24H28O8 — CID 167066251
methyl (3S,8bS)-1,8b-dihydroxy-6-(4-hydroxybutoxy)-8-methoxy-3-phenyl-1,2,3,3a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxylate (PubChem CID 167066251) has the molecular formula C24H28O8 and a molecular weight of 444.48 g/mol. Its IUPAC name is methyl (3S,8bS)-1,8b-dihydroxy-6-(4-hydroxybutoxy)-8-methoxy-3-phenyl-1,2,3,3a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxylate.
| Compound Name | methyl (3S,8bS)-1,8b-dihydroxy-6-(4-hydroxybutoxy)-8-methoxy-3-phenyl-1,2,3,3a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 167066251 |
| Molecular Formula | C24H28O8 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | methyl (3S,8bS)-1,8b-dihydroxy-6-(4-hydroxybutoxy)-8-methoxy-3-phenyl-1,2,3,3a-tetrahydrocyclopenta[b][1]benzofuran-2-carboxylate |
| SMILES | COC(=O)C1C(O)[C@@]2(O)c3c(OC)cc(OCCCCO)cc3OC2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H28O8/c1-29-16-12-15(31-11-7-6-10-25)13-17-20(16)24(28)21(26)19(23(27)30-2)18(22(24)32-17)14-8-4-3-5-9-14/h3-5,8-9,12-13,18-19,21-22,25-26,28H,6-7,10-11H2,1-2H3/t18-,19?,21?,22?,24+/m1/s1 |
| InChIKey | WTVRZUSDOOATPQ-NOTWLFEUSA-N |
| XLogP | 1.74 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|