C13H18F3NO3 — CID 167066621
2-[(3Z,5E)-5-methoxyocta-3,5,7-trienoxy]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 167066621) has the molecular formula C13H18F3NO3 and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-[(3Z,5E)-5-methoxyocta-3,5,7-trienoxy]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[(3Z,5E)-5-methoxyocta-3,5,7-trienoxy]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 167066621 |
| Molecular Formula | C13H18F3NO3 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-[(3Z,5E)-5-methoxyocta-3,5,7-trienoxy]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C=C/C=C(\C=C/CCOCC(=O)NCC(F)(F)F)OC |
| InChI | InChI=1S/C13H18F3NO3/c1-3-6-11(19-2)7-4-5-8-20-9-12(18)17-10-13(14,15)16/h3-4,6-7H,1,5,8-10H2,2H3,(H,17,18)/b7-4-,11-6+ |
| InChIKey | ZLOLTXHEWKSRDV-MBHGMHKNSA-N |
| XLogP | 2.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|