About 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one
6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 167066836) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| PubChem CID | 167066836 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | C=C(OCC)c1cnc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H14N2O2/c1-3-16-8(2)10-6-9-4-5-11(15)14-12(9)13-7-10/h6-7H,2-5H2,1H3,(H,13,14,15) |
| InChIKey | FFPIIAFZBSQRRT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
The IUPAC name of 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one (CID 167066836) is 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one is C=C(OCC)c1cnc2c(c1)CCC(=O)N2.
What is the InChIKey of 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
The InChIKey is FFPIIAFZBSQRRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-3-16-8(2)10-6-9-4-5-11(15)14-12(9)13-7-10/h6-7H,2-5H2,1H3,(H,13,14,15).
What are the key properties of 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one?
6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one has a molecular weight of 218.26 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-ethoxyethenyl)-3,4-dihydro-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 167066836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).