C28H17Cl2FN8O2 — CID 167067021
9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one (PubChem CID 167067021) has the molecular formula C28H17Cl2FN8O2 and a molecular weight of 587.40 g/mol. Its IUPAC name is 9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one.
| Compound Name | 9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one |
|---|---|
| PubChem CID | 167067021 |
| Molecular Formula | C28H17Cl2FN8O2 |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 586.08 |
| IUPAC Name | 9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one |
| SMILES | O=C1CCc2cc(-c3nc(C4C5=CC5c5nc(-c6cc(Cl)ccc6-n6cc(Cl)nn6)cc(=O)n54)[nH]c3F)ccc2N1 |
| InChI | InChI=1S/C28H17Cl2FN8O2/c29-14-3-5-20(38-11-21(30)36-37-38)17(8-14)19-10-23(41)39-25(15-9-16(15)28(39)33-19)27-34-24(26(31)35-27)13-1-4-18-12(7-13)2-6-22(40)32-18/h1,3-5,7-11,16,25H,2,6H2,(H,32,40)(H,34,35) |
| InChIKey | LSCMKFKXUKCJEJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|