C28H16Cl2F2N8O2 — CID 167067029
9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(5-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one (PubChem CID 167067029) has the molecular formula C28H16Cl2F2N8O2 and a molecular weight of 605.39 g/mol. Its IUPAC name is 9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(5-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one.
| Compound Name | 9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(5-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one |
|---|---|
| PubChem CID | 167067029 |
| Molecular Formula | C28H16Cl2F2N8O2 |
| Molecular Weight | 605.39 g/mol |
| Exact Mass | 604.07 |
| IUPAC Name | 9-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-[5-fluoro-4-(5-fluoro-2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1H-imidazol-2-yl]-6,10-diazatricyclo[4.4.0.02,4]deca-1(10),3,8-trien-7-one |
| SMILES | O=C1CCc2c(ccc(-c3nc(C4C5=CC5c5nc(-c6cc(Cl)ccc6-n6cc(Cl)nn6)cc(=O)n54)[nH]c3F)c2F)N1 |
| InChI | InChI=1S/C28H16Cl2F2N8O2/c29-11-1-5-19(39-10-20(30)37-38-39)16(7-11)18-9-22(42)40-25(14-8-15(14)28(40)34-18)27-35-24(26(32)36-27)13-2-4-17-12(23(13)31)3-6-21(41)33-17/h1-2,4-5,7-10,15,25H,3,6H2,(H,33,41)(H,35,36) |
| InChIKey | APPCUCUJJDTVRN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|