C26H25ClF8N4OS — CID 167067536
[(3E,5E)-5-(1,1,2,2,2-pentafluoroethyl)-3-(propylamino)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl] 4-chloro-3-[(1-cyanocyclopropyl)carbamoyl]-N-methylbenzenecarboximidothioate (PubChem CID 167067536) has the molecular formula C26H25ClF8N4OS and a molecular weight of 629.02 g/mol. Its IUPAC name is [(3E,5E)-5-(1,1,2,2,2-pentafluoroethyl)-3-(propylamino)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl] 4-chloro-3-[(1-cyanocyclopropyl)carbamoyl]-N-methylbenzenecarboximidothioate.
| Compound Name | [(3E,5E)-5-(1,1,2,2,2-pentafluoroethyl)-3-(propylamino)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl] 4-chloro-3-[(1-cyanocyclopropyl)carbamoyl]-N-methylbenzenecarboximidothioate |
|---|---|
| PubChem CID | 167067536 |
| Molecular Formula | C26H25ClF8N4OS |
| Molecular Weight | 629.02 g/mol |
| Exact Mass | 628.13 |
| IUPAC Name | [(3E,5E)-5-(1,1,2,2,2-pentafluoroethyl)-3-(propylamino)-4-(trifluoromethyl)hepta-1,3,5-trien-2-yl] 4-chloro-3-[(1-cyanocyclopropyl)carbamoyl]-N-methylbenzenecarboximidothioate |
| SMILES | C=C(S/C(=N\C)c1ccc(Cl)c(C(=O)NC2(C#N)CC2)c1)/C(NCCC)=C(C(=C\C)/C(F)(F)C(F)(F)F)\C(F)(F)F |
| InChI | InChI=1S/C26H25ClF8N4OS/c1-5-11-38-20(19(25(30,31)32)17(6-2)24(28,29)26(33,34)35)14(3)41-22(37-4)15-7-8-18(27)16(12-15)21(40)39-23(13-36)9-10-23/h6-8,12,38H,3,5,9-11H2,1-2,4H3,(H,39,40)/b17-6+,20-19+,37-22- |
| InChIKey | TZDHIZPNTCSLNA-HDZKIJBSSA-N |
| XLogP | 7.71 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.02 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|