About [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane
[5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane (PubChem CID 167067598) has the molecular formula C24H45F
and a molecular weight of 352.62 g/mol. Its IUPAC name is [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane.
Molecular Properties
| Compound Name | [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane |
| PubChem CID | 167067598 |
| Molecular Formula | C24H45F |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 352.35 |
| IUPAC Name | [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane |
| SMILES | CCC(CCC(C)C1CCCCC1)CCC1C(F)C(C)(C)C1C(C)C |
| InChI | InChI=1S/C24H45F/c1-7-19(14-13-18(4)20-11-9-8-10-12-20)15-16-21-22(17(2)3)24(5,6)23(21)25/h17-23H,7-16H2,1-6H3 |
| InChIKey | VBZIZKQSAXXYSQ-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane?
The IUPAC name of [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane (CID 167067598) is [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane.
What is the SMILES notation for [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane?
The canonical SMILES for [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane is CCC(CCC(C)C1CCCCC1)CCC1C(F)C(C)(C)C1C(C)C.
What is the InChIKey of [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane?
The InChIKey is VBZIZKQSAXXYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H45F/c1-7-19(14-13-18(4)20-11-9-8-10-12-20)15-16-21-22(17(2)3)24(5,6)23(21)25/h17-23H,7-16H2,1-6H3.
What are the key properties of [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane?
[5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane has a molecular weight of 352.62 g/mol, XLogP of 8.06, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethyl-7-(2-fluoro-3,3-dimethyl-4-propan-2-ylcyclobutyl)heptan-2-yl]cyclohexane is sourced from PubChem (CID 167067598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).