About 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane
2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 167067608) has the molecular formula C10H18N2S
and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 167067608 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | C=C1NC2(CCNCC2)SC1CC |
| InChI | InChI=1S/C10H18N2S/c1-3-9-8(2)12-10(13-9)4-6-11-7-5-10/h9,11-12H,2-7H2,1H3 |
| InChIKey | HPVKZWPPZLRLOV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane (CID 167067608) is 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane is C=C1NC2(CCNCC2)SC1CC.
What is the InChIKey of 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is HPVKZWPPZLRLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-3-9-8(2)12-10(13-9)4-6-11-7-5-10/h9,11-12H,2-7H2,1H3.
What are the key properties of 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane?
2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 198.33 g/mol, XLogP of 1.69, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-methylidene-1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 167067608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).