C19H25F2N — CID 167067875
(2E,5E,7E)-N-ethenyl-N,3-difluoro-4-methylidene-6,7-bis[(Z)-prop-1-enyl]deca-2,5,7-trien-5-amine (PubChem CID 167067875) has the molecular formula C19H25F2N and a molecular weight of 305.41 g/mol. Its IUPAC name is (2E,5E,7E)-N-ethenyl-N,3-difluoro-4-methylidene-6,7-bis[(Z)-prop-1-enyl]deca-2,5,7-trien-5-amine.
| Compound Name | (2E,5E,7E)-N-ethenyl-N,3-difluoro-4-methylidene-6,7-bis[(Z)-prop-1-enyl]deca-2,5,7-trien-5-amine |
|---|---|
| PubChem CID | 167067875 |
| Molecular Formula | C19H25F2N |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (2E,5E,7E)-N-ethenyl-N,3-difluoro-4-methylidene-6,7-bis[(Z)-prop-1-enyl]deca-2,5,7-trien-5-amine |
| SMILES | C=CN(F)C(C(=C)/C(F)=C\C)=C(/C=C\C)C(/C=C\C)=C/CC |
| InChI | InChI=1S/C19H25F2N/c1-7-12-16(13-8-2)17(14-9-3)19(22(21)11-5)15(6)18(20)10-4/h7,9-14H,5-6,8H2,1-4H3/b12-7-,14-9-,16-13+,18-10+,19-17+ |
| InChIKey | WHLZVILALMEXEX-KSPQFYMXSA-N |
| XLogP | 6.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|