C11H19NO3 — CID 167068174
2-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanamine (PubChem CID 167068174) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanamine.
| Compound Name | 2-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanamine |
|---|---|
| PubChem CID | 167068174 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 2-(3,4,5-trimethoxycyclohexa-1,3-dien-1-yl)ethanamine |
| SMILES | COC1=C(OC)C(OC)CC(CCN)=C1 |
| InChI | InChI=1S/C11H19NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6,10H,4-5,7,12H2,1-3H3 |
| InChIKey | NCOUHDOLUQZDIX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |