About (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine
(1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine (PubChem CID 167068202) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine |
| PubChem CID | 167068202 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine |
| SMILES | COCCN(CCOC)[C@@H]1CC=C(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H31NO2/c1-16(2,3)14-6-8-15(9-7-14)17(10-12-18-4)11-13-19-5/h6,15H,7-13H2,1-5H3/t15-/m1/s1 |
| InChIKey | MYHSVUQMYBAJPV-OAHLLOKOSA-N |
| XLogP | 3.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine?
The IUPAC name of (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine (CID 167068202) is (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine.
What is the SMILES notation for (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine?
The canonical SMILES for (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine is COCCN(CCOC)[C@@H]1CC=C(C(C)(C)C)CC1.
What is the InChIKey of (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine?
The InChIKey is MYHSVUQMYBAJPV-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H31NO2/c1-16(2,3)14-6-8-15(9-7-14)17(10-12-18-4)11-13-19-5/h6,15H,7-13H2,1-5H3/t15-/m1/s1.
What are the key properties of (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine?
(1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine has a molecular weight of 269.43 g/mol, XLogP of 3.11, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-tert-butyl-N,N-bis(2-methoxyethyl)cyclohex-3-en-1-amine is sourced from PubChem (CID 167068202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).