About 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea
1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea (PubChem CID 167068491) has the molecular formula C12H26N4O2
and a molecular weight of 258.37 g/mol. Its IUPAC name is 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea.
Molecular Properties
| Compound Name | 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea |
| PubChem CID | 167068491 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)NN(C)NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C12H26N4O2/c1-9(2)8-13-11(18)15-16(6)14-10(17)7-12(3,4)5/h9H,7-8H2,1-6H3,(H,14,17)(H2,13,15,18) |
| InChIKey | KKLLRZOVQCIIBR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea?
The IUPAC name of 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea (CID 167068491) is 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea.
What is the SMILES notation for 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea?
The canonical SMILES for 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea is CC(C)CNC(=O)NN(C)NC(=O)CC(C)(C)C.
What is the InChIKey of 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea?
The InChIKey is KKLLRZOVQCIIBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4O2/c1-9(2)8-13-11(18)15-16(6)14-10(17)7-12(3,4)5/h9H,7-8H2,1-6H3,(H,14,17)(H2,13,15,18).
What are the key properties of 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea?
1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea has a molecular weight of 258.37 g/mol, XLogP of 1.26, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,3-dimethylbutanoylamino)-methylamino]-3-(2-methylpropyl)urea is sourced from PubChem (CID 167068491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).