About (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine
(Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine (PubChem CID 167068493) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine |
| PubChem CID | 167068493 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine |
| SMILES | CC(C)N(C)CC/C=C\CCCC(C)(C)C |
| InChI | InChI=1S/C15H31N/c1-14(2)16(6)13-11-9-7-8-10-12-15(3,4)5/h7,9,14H,8,10-13H2,1-6H3/b9-7- |
| InChIKey | ZVKHRIBEEIDOBH-CLFYSBASSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine?
The IUPAC name of (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine (CID 167068493) is (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine.
What is the SMILES notation for (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine?
The canonical SMILES for (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine is CC(C)N(C)CC/C=C\CCCC(C)(C)C.
What is the InChIKey of (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine?
The InChIKey is ZVKHRIBEEIDOBH-CLFYSBASSA-N. The full InChI is InChI=1S/C15H31N/c1-14(2)16(6)13-11-9-7-8-10-12-15(3,4)5/h7,9,14H,8,10-13H2,1-6H3/b9-7-.
What are the key properties of (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine?
(Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine has a molecular weight of 225.42 g/mol, XLogP of 4.49, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,8,8-trimethyl-N-propan-2-ylnon-3-en-1-amine is sourced from PubChem (CID 167068493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).