C16H29N — CID 167069160
(3E,5Z)-N,3-dimethyl-N,5-di(propan-2-yl)octa-1,3,5-trien-2-amine (PubChem CID 167069160) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (3E,5Z)-N,3-dimethyl-N,5-di(propan-2-yl)octa-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-N,3-dimethyl-N,5-di(propan-2-yl)octa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 167069160 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (3E,5Z)-N,3-dimethyl-N,5-di(propan-2-yl)octa-1,3,5-trien-2-amine |
| SMILES | C=C(/C(C)=C/C(=C\CC)C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C16H29N/c1-9-10-16(12(2)3)11-14(6)15(7)17(8)13(4)5/h10-13H,7,9H2,1-6,8H3/b14-11+,16-10+ |
| InChIKey | GHRWIDZJVUNPLC-VKFAFFLXSA-N |
| XLogP | 4.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|