C15H26N2 — CID 167069355
(1E,3Z,5Z)-1-(4-propan-2-ylpiperidin-1-yl)hepta-1,3,5-trien-1-amine (PubChem CID 167069355) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (1E,3Z,5Z)-1-(4-propan-2-ylpiperidin-1-yl)hepta-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z,5Z)-1-(4-propan-2-ylpiperidin-1-yl)hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 167069355 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (1E,3Z,5Z)-1-(4-propan-2-ylpiperidin-1-yl)hepta-1,3,5-trien-1-amine |
| SMILES | C/C=C\C=C/C=C(\N)N1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C15H26N2/c1-4-5-6-7-8-15(16)17-11-9-14(10-12-17)13(2)3/h4-8,13-14H,9-12,16H2,1-3H3/b5-4-,7-6-,15-8+ |
| InChIKey | DHVOFOBSLIWNEI-MOUIEDEMSA-N |
| XLogP | 3.29 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|