About N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide
N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide (PubChem CID 167069380) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide.
Molecular Properties
| Compound Name | N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide |
| PubChem CID | 167069380 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide |
| SMILES | C=N/C=C\C(=C/C)NC(=O)CCC |
| InChI | InChI=1S/C10H16N2O/c1-4-6-10(13)12-9(5-2)7-8-11-3/h5,7-8H,3-4,6H2,1-2H3,(H,12,13)/b8-7-,9-5+ |
| InChIKey | BXHDSIIRJLSAHQ-ISXYNVPDSA-N |
| XLogP | 2.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide?
The IUPAC name of N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide (CID 167069380) is N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide.
What is the SMILES notation for N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide?
The canonical SMILES for N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide is C=N/C=C\C(=C/C)NC(=O)CCC.
What is the InChIKey of N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide?
The InChIKey is BXHDSIIRJLSAHQ-ISXYNVPDSA-N. The full InChI is InChI=1S/C10H16N2O/c1-4-6-10(13)12-9(5-2)7-8-11-3/h5,7-8H,3-4,6H2,1-2H3,(H,12,13)/b8-7-,9-5+.
What are the key properties of N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide?
N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide has a molecular weight of 180.25 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z,3E)-1-(methylideneamino)penta-1,3-dien-3-yl]butanamide is sourced from PubChem (CID 167069380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).