C13H25FN4O2 — CID 167069667
tert-butyl (3S,5S)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-fluoropiperidine-1-carboxylate (PubChem CID 167069667) has the molecular formula C13H25FN4O2 and a molecular weight of 288.37 g/mol. Its IUPAC name is tert-butyl (3S,5S)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5S)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 167069667 |
| Molecular Formula | C13H25FN4O2 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | tert-butyl (3S,5S)-3-[(N,N'-dimethylcarbamimidoyl)amino]-5-fluoropiperidine-1-carboxylate |
| SMILES | C/N=C(\NC)N[C@H]1C[C@H](F)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H25FN4O2/c1-13(2,3)20-12(19)18-7-9(14)6-10(8-18)17-11(15-4)16-5/h9-10H,6-8H2,1-5H3,(H2,15,16,17)/t9-,10-/m0/s1 |
| InChIKey | MXJZYQWJACNSPU-UWVGGRQHSA-N |
| XLogP | 1.13 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|