About 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol
3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol (PubChem CID 167070063) has the molecular formula C14H10F4O4
and a molecular weight of 318.22 g/mol. Its IUPAC name is 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol.
Molecular Properties
| Compound Name | 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol |
| PubChem CID | 167070063 |
| Molecular Formula | C14H10F4O4 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol |
| SMILES | COc1cc(F)cc(OCOc2c(F)ccc(O)c2F)c1F |
| InChI | InChI=1S/C14H10F4O4/c1-20-10-4-7(15)5-11(13(10)18)21-6-22-14-8(16)2-3-9(19)12(14)17/h2-5,19H,6H2,1H3 |
| InChIKey | VZCAMROBYCPQLP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol?
The IUPAC name of 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol (CID 167070063) is 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol.
What is the SMILES notation for 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol?
The canonical SMILES for 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol is COc1cc(F)cc(OCOc2c(F)ccc(O)c2F)c1F.
What is the InChIKey of 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol?
The InChIKey is VZCAMROBYCPQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F4O4/c1-20-10-4-7(15)5-11(13(10)18)21-6-22-14-8(16)2-3-9(19)12(14)17/h2-5,19H,6H2,1H3.
What are the key properties of 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol?
3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol has a molecular weight of 318.22 g/mol, XLogP of 3.37, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,5-difluoro-3-methoxyphenoxy)methoxy]-2,4-difluorophenol is sourced from PubChem (CID 167070063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).