C7H5F11O2 — CID 167070111
1,1,1,3,3,5,5,5-octafluoro-4-methoxy-2-(trifluoromethyl)pentan-2-ol (PubChem CID 167070111) has the molecular formula C7H5F11O2 and a molecular weight of 330.09 g/mol. Its IUPAC name is 1,1,1,3,3,5,5,5-octafluoro-4-methoxy-2-(trifluoromethyl)pentan-2-ol.
| Compound Name | 1,1,1,3,3,5,5,5-octafluoro-4-methoxy-2-(trifluoromethyl)pentan-2-ol |
|---|---|
| PubChem CID | 167070111 |
| Molecular Formula | C7H5F11O2 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 1,1,1,3,3,5,5,5-octafluoro-4-methoxy-2-(trifluoromethyl)pentan-2-ol |
| SMILES | COC(C(F)(F)F)C(F)(F)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F11O2/c1-20-2(4(10,11)12)3(8,9)5(19,6(13,14)15)7(16,17)18/h2,19H,1H3 |
| InChIKey | ZBZYAFGGPFKDOT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |