C32H34F6N2O5 — CID 167070159
N-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N'-(oxan-2-yloxy)octanediamide (PubChem CID 167070159) has the molecular formula C32H34F6N2O5 and a molecular weight of 640.62 g/mol. Its IUPAC name is N-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N'-(oxan-2-yloxy)octanediamide.
| Compound Name | N-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N'-(oxan-2-yloxy)octanediamide |
|---|---|
| PubChem CID | 167070159 |
| Molecular Formula | C32H34F6N2O5 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | N-[(6E)-6-[[3,5-bis(trifluoromethyl)phenyl]methylidene]-5-oxo-7,8-dihydronaphthalen-2-yl]-N'-(oxan-2-yloxy)octanediamide |
| SMILES | O=C(CCCCCCC(=O)Nc1ccc2c(c1)CC/C(=C\c1cc(C(F)(F)F)cc(C(F)(F)F)c1)C2=O)NOC1CCCCO1 |
| InChI | InChI=1S/C32H34F6N2O5/c33-31(34,35)23-16-20(17-24(19-23)32(36,37)38)15-22-11-10-21-18-25(12-13-26(21)30(22)43)39-27(41)7-3-1-2-4-8-28(42)40-45-29-9-5-6-14-44-29/h12-13,15-19,29H,1-11,14H2,(H,39,41)(H,40,42)/b22-15+ |
| InChIKey | GCVLJGBKNMBWHJ-PXLXIMEGSA-N |
| XLogP | 7.79 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|